C24H16F3NO5S — CID 15347466
2-[2-(naphthalen-2-ylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoic acid (PubChem CID 15347466) has the molecular formula C24H16F3NO5S and a molecular weight of 487.46 g/mol. Its IUPAC name is 2-[2-(naphthalen-2-ylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoic acid.
| Compound Name | 2-[2-(naphthalen-2-ylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 15347466 |
| Molecular Formula | C24H16F3NO5S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 2-[2-(naphthalen-2-ylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1Oc1ccc(C(F)(F)F)cc1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H16F3NO5S/c25-24(26,27)17-10-12-22(33-21-8-4-3-7-19(21)23(29)30)20(14-17)28-34(31,32)18-11-9-15-5-1-2-6-16(15)13-18/h1-14,28H,(H,29,30) |
| InChIKey | QPLUDJGCIRFXOR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |