C24H18F3NO3S — CID 169373057
4-methyl-N-[2-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 169373057) has the molecular formula C24H18F3NO3S and a molecular weight of 457.47 g/mol. Its IUPAC name is 4-methyl-N-[2-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 169373057 |
| Molecular Formula | C24H18F3NO3S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 4-methyl-N-[2-naphthalen-2-yloxy-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(F)(F)F)ccc2Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C24H18F3NO3S/c1-16-6-11-21(12-7-16)32(29,30)28-22-15-19(24(25,26)27)9-13-23(22)31-20-10-8-17-4-2-3-5-18(17)14-20/h2-15,28H,1H3 |
| InChIKey | ZORINNDQUHUWIJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |