C22H25F3NO5S- — CID 152752820
2-[2-(octylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoate (PubChem CID 152752820) has the molecular formula C22H25F3NO5S- and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-[2-(octylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoate.
| Compound Name | 2-[2-(octylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 152752820 |
| Molecular Formula | C22H25F3NO5S- |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[2-(octylsulfonylamino)-4-(trifluoromethyl)phenoxy]benzoate |
| SMILES | CCCCCCCCS(=O)(=O)Nc1cc(C(F)(F)F)ccc1Oc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C22H26F3NO5S/c1-2-3-4-5-6-9-14-32(29,30)26-18-15-16(22(23,24)25)12-13-20(18)31-19-11-8-7-10-17(19)21(27)28/h7-8,10-13,15,26H,2-6,9,14H2,1H3,(H,27,28)/p-1 |
| InChIKey | FVHDPVRQFHAJCC-UHFFFAOYSA-M |
| XLogP | 4.96 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|