C23H31NO4S — CID 122178580
2-(octylsulfonylamino)-5-(2-phenylethyl)benzoic acid (PubChem CID 122178580) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is 2-(octylsulfonylamino)-5-(2-phenylethyl)benzoic acid.
| Compound Name | 2-(octylsulfonylamino)-5-(2-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 122178580 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-(octylsulfonylamino)-5-(2-phenylethyl)benzoic acid |
| SMILES | CCCCCCCCS(=O)(=O)Nc1ccc(CCc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C23H31NO4S/c1-2-3-4-5-6-10-17-29(27,28)24-22-16-15-20(18-21(22)23(25)26)14-13-19-11-8-7-9-12-19/h7-9,11-12,15-16,18,24H,2-6,10,13-14,17H2,1H3,(H,25,26) |
| InChIKey | NMXIGRDWSRATAS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|