C21H26ClNO4S — CID 44608762
5-(4-chlorophenyl)-2-(octylsulfonylamino)benzoic acid (PubChem CID 44608762) has the molecular formula C21H26ClNO4S and a molecular weight of 423.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(octylsulfonylamino)benzoic acid.
| Compound Name | 5-(4-chlorophenyl)-2-(octylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 44608762 |
| Molecular Formula | C21H26ClNO4S |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(octylsulfonylamino)benzoic acid |
| SMILES | CCCCCCCCS(=O)(=O)Nc1ccc(-c2ccc(Cl)cc2)cc1C(=O)O |
| InChI | InChI=1S/C21H26ClNO4S/c1-2-3-4-5-6-7-14-28(26,27)23-20-13-10-17(15-19(20)21(24)25)16-8-11-18(22)12-9-16/h8-13,15,23H,2-7,14H2,1H3,(H,24,25) |
| InChIKey | BVFBKNJTLSEKER-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|