C20H20F3NO4S — CID 171356961
2-[(4-cyclohexylphenyl)sulfonylamino]-5-(trifluoromethyl)benzoic acid (PubChem CID 171356961) has the molecular formula C20H20F3NO4S and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-[(4-cyclohexylphenyl)sulfonylamino]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[(4-cyclohexylphenyl)sulfonylamino]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 171356961 |
| Molecular Formula | C20H20F3NO4S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[(4-cyclohexylphenyl)sulfonylamino]-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1cc(C(F)(F)F)ccc1NS(=O)(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H20F3NO4S/c21-20(22,23)15-8-11-18(17(12-15)19(25)26)24-29(27,28)16-9-6-14(7-10-16)13-4-2-1-3-5-13/h6-13,24H,1-5H2,(H,25,26) |
| InChIKey | FEKBJSQKYKTCID-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |