C14H12F3NO3 — CID 79530221
2-(cyclopent-3-ene-1-carbonylamino)-4-(trifluoromethyl)benzoic acid (PubChem CID 79530221) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is 2-(cyclopent-3-ene-1-carbonylamino)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(cyclopent-3-ene-1-carbonylamino)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 79530221 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(cyclopent-3-ene-1-carbonylamino)-4-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1NC(=O)C1CC=CC1 |
| InChI | InChI=1S/C14H12F3NO3/c15-14(16,17)9-5-6-10(13(20)21)11(7-9)18-12(19)8-3-1-2-4-8/h1-2,5-8H,3-4H2,(H,18,19)(H,20,21) |
| InChIKey | DKFQYZQWKILCTF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|