C14H18ClF5N2OS — CID 119795133
N-[2-(2,2-difluoroethylsulfanyl)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119795133) has the molecular formula C14H18ClF5N2OS and a molecular weight of 392.82 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethylsulfanyl)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[2-(2,2-difluoroethylsulfanyl)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119795133 |
| Molecular Formula | C14H18ClF5N2OS |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-[2-(2,2-difluoroethylsulfanyl)-5-(trifluoromethyl)phenyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)Nc1cc(C(F)(F)F)ccc1SCC(F)F.Cl |
| InChI | InChI=1S/C14H17F5N2OS.ClH/c1-20-6-2-3-13(22)21-10-7-9(14(17,18)19)4-5-11(10)23-8-12(15)16;/h4-5,7,12,20H,2-3,6,8H2,1H3,(H,21,22);1H |
| InChIKey | UFHQYOOKUWGALG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|