C13H20Cl2F3N3O — CID 119893557
2-(methylamino)-N-[2-(propylamino)-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride (PubChem CID 119893557) has the molecular formula C13H20Cl2F3N3O and a molecular weight of 362.22 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-(propylamino)-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-(methylamino)-N-[2-(propylamino)-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119893557 |
| Molecular Formula | C13H20Cl2F3N3O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-(methylamino)-N-[2-(propylamino)-5-(trifluoromethyl)phenyl]acetamide;dihydrochloride |
| SMILES | CCCNc1ccc(C(F)(F)F)cc1NC(=O)CNC.Cl.Cl |
| InChI | InChI=1S/C13H18F3N3O.2ClH/c1-3-6-18-10-5-4-9(13(14,15)16)7-11(10)19-12(20)8-17-2;;/h4-5,7,17-18H,3,6,8H2,1-2H3,(H,19,20);2*1H |
| InChIKey | AEBMMNNAJLYDBC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |