C12H20N2O — CID 115121186
1-amino-3-(2,3,4-trimethylanilino)propan-2-ol (PubChem CID 115121186) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-amino-3-(2,3,4-trimethylanilino)propan-2-ol.
| Compound Name | 1-amino-3-(2,3,4-trimethylanilino)propan-2-ol |
|---|---|
| PubChem CID | 115121186 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-amino-3-(2,3,4-trimethylanilino)propan-2-ol |
| SMILES | Cc1ccc(NCC(O)CN)c(C)c1C |
| InChI | InChI=1S/C12H20N2O/c1-8-4-5-12(10(3)9(8)2)14-7-11(15)6-13/h4-5,11,14-15H,6-7,13H2,1-3H3 |
| InChIKey | WBVYLIQRWUSICB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |