C13H22N2O — CID 115121441
1-amino-3-[(2,3,4-trimethylphenyl)methylamino]propan-2-ol (PubChem CID 115121441) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-amino-3-[(2,3,4-trimethylphenyl)methylamino]propan-2-ol.
| Compound Name | 1-amino-3-[(2,3,4-trimethylphenyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 115121441 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 1-amino-3-[(2,3,4-trimethylphenyl)methylamino]propan-2-ol |
| SMILES | Cc1ccc(CNCC(O)CN)c(C)c1C |
| InChI | InChI=1S/C13H22N2O/c1-9-4-5-12(11(3)10(9)2)7-15-8-13(16)6-14/h4-5,13,15-16H,6-8,14H2,1-3H3 |
| InChIKey | OVULBMIALDUIBL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |