C13H21NO2 — CID 115258612
N-(methoxymethyl)-1-(4-methoxy-2,3,6-trimethylphenyl)methanamine (PubChem CID 115258612) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(methoxymethyl)-1-(4-methoxy-2,3,6-trimethylphenyl)methanamine.
| Compound Name | N-(methoxymethyl)-1-(4-methoxy-2,3,6-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 115258612 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-(methoxymethyl)-1-(4-methoxy-2,3,6-trimethylphenyl)methanamine |
| SMILES | COCNCc1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C13H21NO2/c1-9-6-13(16-5)11(3)10(2)12(9)7-14-8-15-4/h6,14H,7-8H2,1-5H3 |
| InChIKey | LABSYTBQFXCCOU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|