C12H19NO2 — CID 22238091
2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine (PubChem CID 22238091) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine.
| Compound Name | 2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 22238091 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine |
| SMILES | COc1cc(CCN)c(OC)c(C)c1C |
| InChI | InChI=1S/C12H19NO2/c1-8-9(2)12(15-4)10(5-6-13)7-11(8)14-3/h7H,5-6,13H2,1-4H3 |
| InChIKey | NFOHGLKGLZIHJQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |