C13H18O4 — CID 15812003
methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)acetate (PubChem CID 15812003) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)acetate.
| Compound Name | methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 15812003 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | methyl 2-(2,5-dimethoxy-3,4-dimethylphenyl)acetate |
| SMILES | COC(=O)Cc1cc(OC)c(C)c(C)c1OC |
| InChI | InChI=1S/C13H18O4/c1-8-9(2)13(17-5)10(6-11(8)15-3)7-12(14)16-4/h6H,7H2,1-5H3 |
| InChIKey | QMXFLBAEPDLITQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |