C12H14BrClO4 — CID 154091965
methyl 2-[2-bromo-3-(chloromethyl)-4,5-dimethoxyphenyl]acetate (PubChem CID 154091965) has the molecular formula C12H14BrClO4 and a molecular weight of 337.60 g/mol. Its IUPAC name is methyl 2-[2-bromo-3-(chloromethyl)-4,5-dimethoxyphenyl]acetate.
| Compound Name | methyl 2-[2-bromo-3-(chloromethyl)-4,5-dimethoxyphenyl]acetate |
|---|---|
| PubChem CID | 154091965 |
| Molecular Formula | C12H14BrClO4 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | methyl 2-[2-bromo-3-(chloromethyl)-4,5-dimethoxyphenyl]acetate |
| SMILES | COC(=O)Cc1cc(OC)c(OC)c(CCl)c1Br |
| InChI | InChI=1S/C12H14BrClO4/c1-16-9-4-7(5-10(15)17-2)11(13)8(6-14)12(9)18-3/h4H,5-6H2,1-3H3 |
| InChIKey | QNNICOYJPFFFSV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|