C11H12BrClO4 — CID 154229520
2-[6-bromo-2-(chloromethyl)-3,4-dimethoxyphenyl]acetic acid (PubChem CID 154229520) has the molecular formula C11H12BrClO4 and a molecular weight of 323.57 g/mol. Its IUPAC name is 2-[6-bromo-2-(chloromethyl)-3,4-dimethoxyphenyl]acetic acid.
| Compound Name | 2-[6-bromo-2-(chloromethyl)-3,4-dimethoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 154229520 |
| Molecular Formula | C11H12BrClO4 |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 2-[6-bromo-2-(chloromethyl)-3,4-dimethoxyphenyl]acetic acid |
| SMILES | COc1cc(Br)c(CC(=O)O)c(CCl)c1OC |
| InChI | InChI=1S/C11H12BrClO4/c1-16-9-4-8(12)6(3-10(14)15)7(5-13)11(9)17-2/h4H,3,5H2,1-2H3,(H,14,15) |
| InChIKey | IOIOJZYNCBTAME-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|