C11H10ClNO4S — CID 19770776
2-(2-chloro-6-isothiocyanato-3,4-dimethoxyphenyl)acetic acid (PubChem CID 19770776) has the molecular formula C11H10ClNO4S and a molecular weight of 287.72 g/mol. Its IUPAC name is 2-(2-chloro-6-isothiocyanato-3,4-dimethoxyphenyl)acetic acid.
| Compound Name | 2-(2-chloro-6-isothiocyanato-3,4-dimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 19770776 |
| Molecular Formula | C11H10ClNO4S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-(2-chloro-6-isothiocyanato-3,4-dimethoxyphenyl)acetic acid |
| SMILES | COc1cc(N=C=S)c(CC(=O)O)c(Cl)c1OC |
| InChI | InChI=1S/C11H10ClNO4S/c1-16-8-4-7(13-5-18)6(3-9(14)15)10(12)11(8)17-2/h4H,3H2,1-2H3,(H,14,15) |
| InChIKey | HZZONYJKQSQXQX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|