C13H21N3O3 — CID 116848706
2-amino-3-(2,5-dimethoxy-3,4-dimethylphenyl)propanehydrazide (PubChem CID 116848706) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-amino-3-(2,5-dimethoxy-3,4-dimethylphenyl)propanehydrazide.
| Compound Name | 2-amino-3-(2,5-dimethoxy-3,4-dimethylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116848706 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-amino-3-(2,5-dimethoxy-3,4-dimethylphenyl)propanehydrazide |
| SMILES | COc1cc(CC(N)C(=O)NN)c(OC)c(C)c1C |
| InChI | InChI=1S/C13H21N3O3/c1-7-8(2)12(19-4)9(6-11(7)18-3)5-10(14)13(17)16-15/h6,10H,5,14-15H2,1-4H3,(H,16,17) |
| InChIKey | LGVXJWCYCOUPDC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|