C12H19N3O4 — CID 116848669
2-amino-3-(2,4,5-trimethoxyphenyl)propanehydrazide (PubChem CID 116848669) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-amino-3-(2,4,5-trimethoxyphenyl)propanehydrazide.
| Compound Name | 2-amino-3-(2,4,5-trimethoxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116848669 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-amino-3-(2,4,5-trimethoxyphenyl)propanehydrazide |
| SMILES | COc1cc(OC)c(OC)cc1CC(N)C(=O)NN |
| InChI | InChI=1S/C12H19N3O4/c1-17-9-6-11(19-3)10(18-2)5-7(9)4-8(13)12(16)15-14/h5-6,8H,4,13-14H2,1-3H3,(H,15,16) |
| InChIKey | VWVWIENNNAOVJI-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|