C12H16O5S — CID 54919137
2-sulfanyl-3-(2,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 54919137) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-sulfanyl-3-(2,4,5-trimethoxyphenyl)propanoic acid.
| Compound Name | 2-sulfanyl-3-(2,4,5-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 54919137 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-sulfanyl-3-(2,4,5-trimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(OC)c(OC)cc1CC(S)C(=O)O |
| InChI | InChI=1S/C12H16O5S/c1-15-8-6-10(17-3)9(16-2)4-7(8)5-11(18)12(13)14/h4,6,11,18H,5H2,1-3H3,(H,13,14) |
| InChIKey | IDIRHVXLWQSGNS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|