C29H32O7 — CID 66702479
bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate (PubChem CID 66702479) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate.
| Compound Name | bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 66702479 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate |
| SMILES | COc1cc(OC)c(OC)cc1CC(C(=O)OCCc1ccccc1)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C29H32O7/c1-32-25-20-27(34-3)26(33-2)19-23(25)18-24(28(30)35-16-14-21-10-6-4-7-11-21)29(31)36-17-15-22-12-8-5-9-13-22/h4-13,19-20,24H,14-18H2,1-3H3 |
| InChIKey | QVCIIAAKQAEDPD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|