About bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate
bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate (PubChem CID 66702479) has the molecular formula C29H32O7
and a molecular weight of 492.57 g/mol. Its IUPAC name is bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate.
Molecular Properties
| Compound Name | bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate |
| PubChem CID | 66702479 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate |
| SMILES | COc1cc(OC)c(OC)cc1CC(C(=O)OCCc1ccccc1)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C29H32O7/c1-32-25-20-27(34-3)26(33-2)19-23(25)18-24(28(30)35-16-14-21-10-6-4-7-11-21)29(31)36-17-15-22-12-8-5-9-13-22/h4-13,19-20,24H,14-18H2,1-3H3 |
| InChIKey | QVCIIAAKQAEDPD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate?
The IUPAC name of bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate (CID 66702479) is bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate.
What is the SMILES notation for bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate?
The canonical SMILES for bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate is COc1cc(OC)c(OC)cc1CC(C(=O)OCCc1ccccc1)C(=O)OCCc1ccccc1.
What is the InChIKey of bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate?
The InChIKey is QVCIIAAKQAEDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32O7/c1-32-25-20-27(34-3)26(33-2)19-23(25)18-24(28(30)35-16-14-21-10-6-4-7-11-21)29(31)36-17-15-22-12-8-5-9-13-22/h4-13,19-20,24H,14-18H2,1-3H3.
What are the key properties of bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate?
bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate has a molecular weight of 492.57 g/mol, XLogP of 4.44, 13 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-phenylethyl) 2-[(2,4,5-trimethoxyphenyl)methyl]propanedioate is sourced from PubChem (CID 66702479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).