C28H30O6 — CID 66702297
bis(2-phenylethyl) 2-[(2,5-dimethoxyphenyl)methyl]propanedioate (PubChem CID 66702297) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is bis(2-phenylethyl) 2-[(2,5-dimethoxyphenyl)methyl]propanedioate.
| Compound Name | bis(2-phenylethyl) 2-[(2,5-dimethoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 66702297 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | bis(2-phenylethyl) 2-[(2,5-dimethoxyphenyl)methyl]propanedioate |
| SMILES | COc1ccc(OC)c(CC(C(=O)OCCc2ccccc2)C(=O)OCCc2ccccc2)c1 |
| InChI | InChI=1S/C28H30O6/c1-31-24-13-14-26(32-2)23(19-24)20-25(27(29)33-17-15-21-9-5-3-6-10-21)28(30)34-18-16-22-11-7-4-8-12-22/h3-14,19,25H,15-18,20H2,1-2H3 |
| InChIKey | MWZRBCXCKLATRO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|