C10H12FNO4 — CID 117329895
2-amino-3-(4-fluoro-5-hydroxy-2-methoxyphenyl)propanoic acid (PubChem CID 117329895) has the molecular formula C10H12FNO4 and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-amino-3-(4-fluoro-5-hydroxy-2-methoxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-fluoro-5-hydroxy-2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117329895 |
| Molecular Formula | C10H12FNO4 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 2-amino-3-(4-fluoro-5-hydroxy-2-methoxyphenyl)propanoic acid |
| SMILES | COc1cc(F)c(O)cc1CC(N)C(=O)O |
| InChI | InChI=1S/C10H12FNO4/c1-16-9-4-6(11)8(13)3-5(9)2-7(12)10(14)15/h3-4,7,13H,2,12H2,1H3,(H,14,15) |
| InChIKey | GSKDOOKCWXXABU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |