C10H10BrF2NO3 — CID 117494622
2-amino-3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanoic acid (PubChem CID 117494622) has the molecular formula C10H10BrF2NO3 and a molecular weight of 310.09 g/mol. Its IUPAC name is 2-amino-3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117494622 |
| Molecular Formula | C10H10BrF2NO3 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 2-amino-3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanoic acid |
| SMILES | COc1cc(F)c(CC(N)C(=O)O)c(F)c1Br |
| InChI | InChI=1S/C10H10BrF2NO3/c1-17-7-3-5(12)4(9(13)8(7)11)2-6(14)10(15)16/h3,6H,2,14H2,1H3,(H,15,16) |
| InChIKey | OUFMIZVYYUXERW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|