C9H6BrF4NO2 — CID 117115250
2-amino-3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanoic acid (PubChem CID 117115250) has the molecular formula C9H6BrF4NO2 and a molecular weight of 316.05 g/mol. Its IUPAC name is 2-amino-3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanoic acid.
| Compound Name | 2-amino-3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 117115250 |
| Molecular Formula | C9H6BrF4NO2 |
| Molecular Weight | 316.05 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 2-amino-3-(4-bromo-2,3,5,6-tetrafluorophenyl)propanoic acid |
| SMILES | NC(Cc1c(F)c(F)c(Br)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C9H6BrF4NO2/c10-4-7(13)5(11)2(6(12)8(4)14)1-3(15)9(16)17/h3H,1,15H2,(H,16,17) |
| InChIKey | RVGFNNZXWKILBS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.05 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|