C10H11BrFNO3 — CID 117471347
2-amino-3-(3-bromo-5-fluoro-2-hydroxy-6-methylphenyl)propanoic acid (PubChem CID 117471347) has the molecular formula C10H11BrFNO3 and a molecular weight of 292.10 g/mol. Its IUPAC name is 2-amino-3-(3-bromo-5-fluoro-2-hydroxy-6-methylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-bromo-5-fluoro-2-hydroxy-6-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117471347 |
| Molecular Formula | C10H11BrFNO3 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-amino-3-(3-bromo-5-fluoro-2-hydroxy-6-methylphenyl)propanoic acid |
| SMILES | Cc1c(F)cc(Br)c(O)c1CC(N)C(=O)O |
| InChI | InChI=1S/C10H11BrFNO3/c1-4-5(2-8(13)10(15)16)9(14)6(11)3-7(4)12/h3,8,14H,2,13H2,1H3,(H,15,16) |
| InChIKey | YIFZWVHVTSLYGV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |