C10H12FNO3 — CID 84679519
2-amino-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoic acid (PubChem CID 84679519) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is 2-amino-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoic acid.
| Compound Name | 2-amino-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 84679519 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-amino-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(F)c(CC(N)C(=O)O)c1O |
| InChI | InChI=1S/C10H12FNO3/c1-5-2-3-7(11)6(9(5)13)4-8(12)10(14)15/h2-3,8,13H,4,12H2,1H3,(H,14,15) |
| InChIKey | SYIFNWHDWWUIMT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |