C12H16FNO5 — CID 117435384
2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 117435384) has the molecular formula C12H16FNO5 and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid.
| Compound Name | 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117435384 |
| Molecular Formula | C12H16FNO5 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(CC(N)C(=O)O)c(OC)c(F)c1OC |
| InChI | InChI=1S/C12H16FNO5/c1-17-8-5-6(4-7(14)12(15)16)10(18-2)9(13)11(8)19-3/h5,7H,4,14H2,1-3H3,(H,15,16) |
| InChIKey | JUXIOABTJWQOAA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |