2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid

C12H16FNO5 — CID 117435384

IUPAC2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid
SMILESCOc1cc(CC(N)C(=O)O)c(OC)c(F)c1OC
InChIInChI=1S/C12H16FNO5/c1-17-8-5-6(4-7(14)12(15)16)10(18-2)9(13)11(8)19-3/h5,7H,4,14H2,1-3H3,(H,15,16)
InChIKeyJUXIOABTJWQOAA-UHFFFAOYSA-N
MW273.26 g/mol
LogP0.81
Rot. Bonds6

About 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid

2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 117435384) has the molecular formula C12H16FNO5 and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid
PubChem CID117435384
Molecular FormulaC12H16FNO5
Molecular Weight273.26 g/mol
Exact Mass273.10
IUPAC Name2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid
SMILESCOc1cc(CC(N)C(=O)O)c(OC)c(F)c1OC
InChIInChI=1S/C12H16FNO5/c1-17-8-5-6(4-7(14)12(15)16)10(18-2)9(13)11(8)19-3/h5,7H,4,14H2,1-3H3,(H,15,16)
InChIKeyJUXIOABTJWQOAA-UHFFFAOYSA-N
XLogP0.81
TPSA91.01 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.26
LogP ≤ 50.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid?
The IUPAC name of 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid (CID 117435384) is 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid.
What is the SMILES notation for 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid?
The canonical SMILES for 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid is COc1cc(CC(N)C(=O)O)c(OC)c(F)c1OC.
What is the InChIKey of 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid?
The InChIKey is JUXIOABTJWQOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO5/c1-17-8-5-6(4-7(14)12(15)16)10(18-2)9(13)11(8)19-3/h5,7H,4,14H2,1-3H3,(H,15,16).
What are the key properties of 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid?
2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid has a molecular weight of 273.26 g/mol, XLogP of 0.81, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(3-fluoro-2,4,5-trimethoxyphenyl)propanoic acid is sourced from PubChem (CID 117435384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).