C9H9BrF2O2 — CID 117420943
2-(3-bromo-2,6-difluoro-4-methoxyphenyl)ethanol (PubChem CID 117420943) has the molecular formula C9H9BrF2O2 and a molecular weight of 267.07 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluoro-4-methoxyphenyl)ethanol.
| Compound Name | 2-(3-bromo-2,6-difluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 117420943 |
| Molecular Formula | C9H9BrF2O2 |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 2-(3-bromo-2,6-difluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1cc(F)c(CCO)c(F)c1Br |
| InChI | InChI=1S/C9H9BrF2O2/c1-14-7-4-6(11)5(2-3-13)9(12)8(7)10/h4,13H,2-3H2,1H3 |
| InChIKey | SMKGLSQIWHVQDC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|