C10H9BrF2O2 — CID 117447245
3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanal (PubChem CID 117447245) has the molecular formula C10H9BrF2O2 and a molecular weight of 279.08 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanal.
| Compound Name | 3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanal |
|---|---|
| PubChem CID | 117447245 |
| Molecular Formula | C10H9BrF2O2 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 3-(3-bromo-2,6-difluoro-4-methoxyphenyl)propanal |
| SMILES | COc1cc(F)c(CCC=O)c(F)c1Br |
| InChI | InChI=1S/C10H9BrF2O2/c1-15-8-5-7(12)6(3-2-4-14)10(13)9(8)11/h4-5H,2-3H2,1H3 |
| InChIKey | LFCSXPZMDKACIN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|