C9H10BrF2NO2 — CID 117452889
1-(3-bromo-2,6-difluoro-4-methoxyphenyl)-N-methoxymethanamine (PubChem CID 117452889) has the molecular formula C9H10BrF2NO2 and a molecular weight of 282.08 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluoro-4-methoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(3-bromo-2,6-difluoro-4-methoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117452889 |
| Molecular Formula | C9H10BrF2NO2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 1-(3-bromo-2,6-difluoro-4-methoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1c(F)cc(OC)c(Br)c1F |
| InChI | InChI=1S/C9H10BrF2NO2/c1-14-7-3-6(11)5(4-13-15-2)9(12)8(7)10/h3,13H,4H2,1-2H3 |
| InChIKey | MKJPSPIKNNUXMA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|