C10H13F2NO3 — CID 117337456
1-(3,5-difluoro-2,6-dimethoxyphenyl)-N-methoxymethanamine (PubChem CID 117337456) has the molecular formula C10H13F2NO3 and a molecular weight of 233.21 g/mol. Its IUPAC name is 1-(3,5-difluoro-2,6-dimethoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(3,5-difluoro-2,6-dimethoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117337456 |
| Molecular Formula | C10H13F2NO3 |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 1-(3,5-difluoro-2,6-dimethoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1c(OC)c(F)cc(F)c1OC |
| InChI | InChI=1S/C10H13F2NO3/c1-14-9-6(5-13-16-3)10(15-2)8(12)4-7(9)11/h4,13H,5H2,1-3H3 |
| InChIKey | UIQDJMUIQHKYCU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|