C10H13BrFNO3 — CID 117474393
1-(3-bromo-5-fluoro-2,4-dimethoxyphenyl)-N-methoxymethanamine (PubChem CID 117474393) has the molecular formula C10H13BrFNO3 and a molecular weight of 294.12 g/mol. Its IUPAC name is 1-(3-bromo-5-fluoro-2,4-dimethoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(3-bromo-5-fluoro-2,4-dimethoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117474393 |
| Molecular Formula | C10H13BrFNO3 |
| Molecular Weight | 294.12 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 1-(3-bromo-5-fluoro-2,4-dimethoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1cc(F)c(OC)c(Br)c1OC |
| InChI | InChI=1S/C10H13BrFNO3/c1-14-9-6(5-13-16-3)4-7(12)10(15-2)8(9)11/h4,13H,5H2,1-3H3 |
| InChIKey | MXJWZWMINBZTDR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|