C8H9BrFNO2 — CID 84803833
3-bromo-5-fluoro-2,4-dimethoxyaniline (PubChem CID 84803833) has the molecular formula C8H9BrFNO2 and a molecular weight of 250.07 g/mol. Its IUPAC name is 3-bromo-5-fluoro-2,4-dimethoxyaniline.
| Compound Name | 3-bromo-5-fluoro-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 84803833 |
| Molecular Formula | C8H9BrFNO2 |
| Molecular Weight | 250.07 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 3-bromo-5-fluoro-2,4-dimethoxyaniline |
| SMILES | COc1c(N)cc(F)c(OC)c1Br |
| InChI | InChI=1S/C8H9BrFNO2/c1-12-7-4(10)3-5(11)8(13-2)6(7)9/h3H,11H2,1-2H3 |
| InChIKey | GUBJOSLSZJPCLA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.07 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|