C7H6F2OS — CID 50998081
3,5-difluoro-4-methoxybenzenethiol (PubChem CID 50998081) has the molecular formula C7H6F2OS and a molecular weight of 176.19 g/mol. Its IUPAC name is 3,5-difluoro-4-methoxybenzenethiol.
| Compound Name | 3,5-difluoro-4-methoxybenzenethiol |
|---|---|
| PubChem CID | 50998081 |
| Molecular Formula | C7H6F2OS |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | 3,5-difluoro-4-methoxybenzenethiol |
| SMILES | COc1c(F)cc(S)cc1F |
| InChI | InChI=1S/C7H6F2OS/c1-10-7-5(8)2-4(11)3-6(7)9/h2-3,11H,1H3 |
| InChIKey | BKKFXQYKOYCSKU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|