C10H13F3O — CID 168911616
ethane;1,3,5-trifluoro-2-methoxy-4-methylbenzene (PubChem CID 168911616) has the molecular formula C10H13F3O and a molecular weight of 206.21 g/mol. Its IUPAC name is ethane;1,3,5-trifluoro-2-methoxy-4-methylbenzene.
| Compound Name | ethane;1,3,5-trifluoro-2-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 168911616 |
| Molecular Formula | C10H13F3O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethane;1,3,5-trifluoro-2-methoxy-4-methylbenzene |
| SMILES | CC.COc1c(F)cc(F)c(C)c1F |
| InChI | InChI=1S/C8H7F3O.C2H6/c1-4-5(9)3-6(10)8(12-2)7(4)11;1-2/h3H,1-2H3;1-2H3 |
| InChIKey | PGPIQENNHPVPJT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |