C21H14AlF7O — CID 177045586
bis(3,5-difluoro-2-methylphenyl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane (PubChem CID 177045586) has the molecular formula C21H14AlF7O and a molecular weight of 442.31 g/mol. Its IUPAC name is bis(3,5-difluoro-2-methylphenyl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane.
| Compound Name | bis(3,5-difluoro-2-methylphenyl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane |
|---|---|
| PubChem CID | 177045586 |
| Molecular Formula | C21H14AlF7O |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | bis(3,5-difluoro-2-methylphenyl)-(2,3,5-trifluoro-6-methoxyphenyl)alumane |
| SMILES | COc1c(F)cc(F)c(F)c1[Al](c1cc(F)cc(F)c1C)c1cc(F)cc(F)c1C |
| InChI | InChI=1S/C7H4F3O.2C7H5F2.Al/c1-11-7-3-5(9)4(8)2-6(7)10;2*1-5-2-3-6(8)4-7(5)9;/h2H,1H3;2*3-4H,1H3; |
| InChIKey | UHRGFHZTOXIFJW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|