C19H7AlF10O — CID 177045953
(2,6-difluoro-4-methoxyphenyl)-bis(2,3,5,6-tetrafluorophenyl)alumane (PubChem CID 177045953) has the molecular formula C19H7AlF10O and a molecular weight of 468.23 g/mol. Its IUPAC name is (2,6-difluoro-4-methoxyphenyl)-bis(2,3,5,6-tetrafluorophenyl)alumane.
| Compound Name | (2,6-difluoro-4-methoxyphenyl)-bis(2,3,5,6-tetrafluorophenyl)alumane |
|---|---|
| PubChem CID | 177045953 |
| Molecular Formula | C19H7AlF10O |
| Molecular Weight | 468.23 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | (2,6-difluoro-4-methoxyphenyl)-bis(2,3,5,6-tetrafluorophenyl)alumane |
| SMILES | COc1cc(F)c([Al](c2c(F)c(F)cc(F)c2F)c2c(F)c(F)cc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C7H5F2O.2C6HF4.Al/c1-10-7-3-5(8)2-6(9)4-7;2*7-3-1-4(8)6(10)2-5(3)9;/h3-4H,1H3;2*1H; |
| InChIKey | NLJQNEIRJLIRIE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|