C9H8FNO2 — CID 130064686
4-fluoro-6-methoxy-2,3-dihydroisoindol-1-one (PubChem CID 130064686) has the molecular formula C9H8FNO2 and a molecular weight of 181.17 g/mol. Its IUPAC name is 4-fluoro-6-methoxy-2,3-dihydroisoindol-1-one.
| Compound Name | 4-fluoro-6-methoxy-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 130064686 |
| Molecular Formula | C9H8FNO2 |
| Molecular Weight | 181.17 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 4-fluoro-6-methoxy-2,3-dihydroisoindol-1-one |
| SMILES | COc1cc(F)c2c(c1)C(=O)NC2 |
| InChI | InChI=1S/C9H8FNO2/c1-13-5-2-6-7(8(10)3-5)4-11-9(6)12/h2-3H,4H2,1H3,(H,11,12) |
| InChIKey | HHZMEXVFBWPNQJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |