C13H8FNO3 — CID 169335304
5-(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carbaldehyde (PubChem CID 169335304) has the molecular formula C13H8FNO3 and a molecular weight of 245.21 g/mol. Its IUPAC name is 5-(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carbaldehyde.
| Compound Name | 5-(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335304 |
| Molecular Formula | C13H8FNO3 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 5-(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(F)c3c(c2)C(=O)NC3)o1 |
| InChI | InChI=1S/C13H8FNO3/c14-11-4-7(12-2-1-8(6-16)18-12)3-9-10(11)5-15-13(9)17/h1-4,6H,5H2,(H,15,17) |
| InChIKey | OQVXLFHUROZEGG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|