C11H6Br2O3 — CID 169332104
5-(3,5-dibromo-4-hydroxyphenyl)furan-2-carbaldehyde (PubChem CID 169332104) has the molecular formula C11H6Br2O3 and a molecular weight of 345.97 g/mol. Its IUPAC name is 5-(3,5-dibromo-4-hydroxyphenyl)furan-2-carbaldehyde.
| Compound Name | 5-(3,5-dibromo-4-hydroxyphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169332104 |
| Molecular Formula | C11H6Br2O3 |
| Molecular Weight | 345.97 g/mol |
| Exact Mass | 343.87 |
| IUPAC Name | 5-(3,5-dibromo-4-hydroxyphenyl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(Br)c(O)c(Br)c2)o1 |
| InChI | InChI=1S/C11H6Br2O3/c12-8-3-6(4-9(13)11(8)15)10-2-1-7(5-14)16-10/h1-5,15H |
| InChIKey | XOBWMKLRIMVQBZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.97 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|