C12H8Br2O2 — CID 43155821
5-(2,6-dibromo-4-methylphenyl)furan-2-carbaldehyde (PubChem CID 43155821) has the molecular formula C12H8Br2O2 and a molecular weight of 344.00 g/mol. Its IUPAC name is 5-(2,6-dibromo-4-methylphenyl)furan-2-carbaldehyde.
| Compound Name | 5-(2,6-dibromo-4-methylphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 43155821 |
| Molecular Formula | C12H8Br2O2 |
| Molecular Weight | 344.00 g/mol |
| Exact Mass | 341.89 |
| IUPAC Name | 5-(2,6-dibromo-4-methylphenyl)furan-2-carbaldehyde |
| SMILES | Cc1cc(Br)c(-c2ccc(C=O)o2)c(Br)c1 |
| InChI | InChI=1S/C12H8Br2O2/c1-7-4-9(13)12(10(14)5-7)11-3-2-8(6-15)16-11/h2-6H,1H3 |
| InChIKey | OOUUTLUXXOEXQE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|