C11H5BrI2O2 — CID 169333081
5-(4-bromo-2,6-diiodophenyl)furan-2-carbaldehyde (PubChem CID 169333081) has the molecular formula C11H5BrI2O2 and a molecular weight of 502.87 g/mol. Its IUPAC name is 5-(4-bromo-2,6-diiodophenyl)furan-2-carbaldehyde.
| Compound Name | 5-(4-bromo-2,6-diiodophenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333081 |
| Molecular Formula | C11H5BrI2O2 |
| Molecular Weight | 502.87 g/mol |
| Exact Mass | 501.76 |
| IUPAC Name | 5-(4-bromo-2,6-diiodophenyl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2c(I)cc(Br)cc2I)o1 |
| InChI | InChI=1S/C11H5BrI2O2/c12-6-3-8(13)11(9(14)4-6)10-2-1-7(5-15)16-10/h1-5H |
| InChIKey | BQXRUVJGPUMHAG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.87 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|