C12H6Br2O3 — CID 169335894
5-(2,4-dibromo-6-formylphenyl)furan-2-carbaldehyde (PubChem CID 169335894) has the molecular formula C12H6Br2O3 and a molecular weight of 357.99 g/mol. Its IUPAC name is 5-(2,4-dibromo-6-formylphenyl)furan-2-carbaldehyde.
| Compound Name | 5-(2,4-dibromo-6-formylphenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335894 |
| Molecular Formula | C12H6Br2O3 |
| Molecular Weight | 357.99 g/mol |
| Exact Mass | 355.87 |
| IUPAC Name | 5-(2,4-dibromo-6-formylphenyl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2c(Br)cc(Br)cc2C=O)o1 |
| InChI | InChI=1S/C12H6Br2O3/c13-8-3-7(5-15)12(10(14)4-8)11-2-1-9(6-16)17-11/h1-6H |
| InChIKey | IWZIKUGMNCKHBK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.99 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|