C11H5BrCl2O2 — CID 91674669
5-(4-bromo-2,5-dichlorophenyl)furan-2-carbaldehyde (PubChem CID 91674669) has the molecular formula C11H5BrCl2O2 and a molecular weight of 319.97 g/mol. Its IUPAC name is 5-(4-bromo-2,5-dichlorophenyl)furan-2-carbaldehyde.
| Compound Name | 5-(4-bromo-2,5-dichlorophenyl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 91674669 |
| Molecular Formula | C11H5BrCl2O2 |
| Molecular Weight | 319.97 g/mol |
| Exact Mass | 317.88 |
| IUPAC Name | 5-(4-bromo-2,5-dichlorophenyl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(Cl)c(Br)cc2Cl)o1 |
| InChI | InChI=1S/C11H5BrCl2O2/c12-8-4-9(13)7(3-10(8)14)11-2-1-6(5-15)16-11/h1-5H |
| InChIKey | SUPJFTGJLXTKOX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|