C14H10I2O4 — CID 169333618
ethyl 4-(5-formylfuran-2-yl)-3,5-diiodobenzoate (PubChem CID 169333618) has the molecular formula C14H10I2O4 and a molecular weight of 496.04 g/mol. Its IUPAC name is ethyl 4-(5-formylfuran-2-yl)-3,5-diiodobenzoate.
| Compound Name | ethyl 4-(5-formylfuran-2-yl)-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 169333618 |
| Molecular Formula | C14H10I2O4 |
| Molecular Weight | 496.04 g/mol |
| Exact Mass | 495.87 |
| IUPAC Name | ethyl 4-(5-formylfuran-2-yl)-3,5-diiodobenzoate |
| SMILES | CCOC(=O)c1cc(I)c(-c2ccc(C=O)o2)c(I)c1 |
| InChI | InChI=1S/C14H10I2O4/c1-2-19-14(18)8-5-10(15)13(11(16)6-8)12-4-3-9(7-17)20-12/h3-7H,2H2,1H3 |
| InChIKey | IBDYZIXVBYPNHG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.04 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|