C12H7NO5S — CID 169335383
5-(1,1,3-trioxo-1,2-benzothiazol-6-yl)furan-2-carbaldehyde (PubChem CID 169335383) has the molecular formula C12H7NO5S and a molecular weight of 277.26 g/mol. Its IUPAC name is 5-(1,1,3-trioxo-1,2-benzothiazol-6-yl)furan-2-carbaldehyde.
| Compound Name | 5-(1,1,3-trioxo-1,2-benzothiazol-6-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335383 |
| Molecular Formula | C12H7NO5S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 5-(1,1,3-trioxo-1,2-benzothiazol-6-yl)furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc3c(c2)S(=O)(=O)NC3=O)o1 |
| InChI | InChI=1S/C12H7NO5S/c14-6-8-2-4-10(18-8)7-1-3-9-11(5-7)19(16,17)13-12(9)15/h1-6H,(H,13,15) |
| InChIKey | SATUTSFDLOCMGU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|