C16H13NO4 — CID 675050
5-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)furan-2-carbaldehyde (PubChem CID 675050) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 5-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)furan-2-carbaldehyde.
| Compound Name | 5-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 675050 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)furan-2-carbaldehyde |
| SMILES | CC(C)N1C(=O)c2ccc(-c3ccc(C=O)o3)cc2C1=O |
| InChI | InChI=1S/C16H13NO4/c1-9(2)17-15(19)12-5-3-10(7-13(12)16(17)20)14-6-4-11(8-18)21-14/h3-9H,1-2H3 |
| InChIKey | RIAMRGMDCNSMLJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|