C14H15NO4S — CID 169335264
5-(5-formylfuran-2-yl)-N,N,2-trimethylbenzenesulfonamide (PubChem CID 169335264) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 5-(5-formylfuran-2-yl)-N,N,2-trimethylbenzenesulfonamide.
| Compound Name | 5-(5-formylfuran-2-yl)-N,N,2-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 169335264 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 5-(5-formylfuran-2-yl)-N,N,2-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(-c2ccc(C=O)o2)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H15NO4S/c1-10-4-5-11(13-7-6-12(9-16)19-13)8-14(10)20(17,18)15(2)3/h4-9H,1-3H3 |
| InChIKey | VHIBAZLOATUKQR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|