C19H15ClO3 — CID 169333455
5-[3-chloro-4-(3,4-dimethylphenoxy)phenyl]furan-2-carbaldehyde (PubChem CID 169333455) has the molecular formula C19H15ClO3 and a molecular weight of 326.78 g/mol. Its IUPAC name is 5-[3-chloro-4-(3,4-dimethylphenoxy)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-chloro-4-(3,4-dimethylphenoxy)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333455 |
| Molecular Formula | C19H15ClO3 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 5-[3-chloro-4-(3,4-dimethylphenoxy)phenyl]furan-2-carbaldehyde |
| SMILES | Cc1ccc(Oc2ccc(-c3ccc(C=O)o3)cc2Cl)cc1C |
| InChI | InChI=1S/C19H15ClO3/c1-12-3-5-15(9-13(12)2)22-19-7-4-14(10-17(19)20)18-8-6-16(11-21)23-18/h3-11H,1-2H3 |
| InChIKey | NXPUUKXLPJVLRF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|